CAS 2713-62-4 appears in our catalog under these names: 2-(Hexafluoro-2-hydroxyisopropyl)aniline, 95%, 2-(2-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 95%, 2-(Hexafluoro-2-hydroxyisopropyl)aniline. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g.
2-(2-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 2713-62-4) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 2-(2-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: HSCFLKMJUGBEEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2-(2-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | HSCFLKMJUGBEEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)(C(F)(F)F)O)N |
Computed by PubChem (NCBI)