CAS 924909-31-9 is the registry number for 3-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline (CAS 924909-31-9) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline. InChIKey: SLQKWZJZVDIVRS-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline |
| InChIKey | SLQKWZJZVDIVRS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)OCC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)