CAS 1019441-72-5 is the registry number for 4-(2,2,2-Trifluoroethoxy)-2-trifluoromethylphenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)aniline (CAS 1019441-72-5) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)aniline. InChIKey: RNBFRCPVUOHYDT-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)aniline |
| InChIKey | RNBFRCPVUOHYDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)