2-(3-Bromophenyl)-5-phenyl-1,3,4-oxadiazole, 97%
cas: 83817-44-1 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)-5-phenyl-1,3,4-oxadiazole, 97% (CAS 83817-44-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A771311-250mg |
| cas | 83817-44-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1097.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole (CAS 83817-44-1) is a chemical compound with the molecular formula C14H9BrN2O and a molecular weight of 301.14 g/mol. IUPAC name: 2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: AWSLTYZLUOJESZ-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | AWSLTYZLUOJESZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)