CAS 83817-43-0 is the registry number for 2-(2-Bromophenyl)-5-phenyl-1,3,4-oxadiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromophenyl)-5-phenyl-1,3,4-oxadiazole (CAS 83817-43-0) is a chemical compound with the molecular formula C14H9BrN2O and a molecular weight of 301.14 g/mol. IUPAC name: 2-(2-bromophenyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: LXTOVESBFFREMZ-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 2-(2-bromophenyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | LXTOVESBFFREMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)