CAS 858117-40-5 is the registry number for (5-Bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)(phenyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-phenylmethanone (CAS 858117-40-5) is a chemical compound with the molecular formula C14H9BrN2O and a molecular weight of 301.14 g/mol. IUPAC name: (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-phenylmethanone. InChIKey: RVCJKCKAFYUWBZ-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-phenylmethanone |
| InChIKey | RVCJKCKAFYUWBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CNC3=C2C=C(C=N3)Br |
Computed by PubChem (NCBI)