Products 827332-78-5

CAS 827332-78-5 is the registry number for 3-(2-Bromophenyl)-5-phenyl-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

3-(2-bromophenyl)-5-phenyl-1,2,4-oxadiazole (CAS 827332-78-5) is a chemical compound with the molecular formula C14H9BrN2O and a molecular weight of 301.14 g/mol. IUPAC name: 3-(2-bromophenyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: YNEFEUXUIWJXNR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9BrN2O
Molecular weight301.14 g/mol
IUPAC name3-(2-bromophenyl)-5-phenyl-1,2,4-oxadiazole
InChIKeyYNEFEUXUIWJXNR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=NO2)C3=CC=CC=C3Br

Computed by PubChem (NCBI)