CAS 83817-44-1 appears in our catalog under these names: 2-(3-Bromophenyl)-5-phenyl-1,3,4-oxadiazole 97%, 2-(3-Bromophenyl)-5-phenyl-1,3,4-oxadiazole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole (CAS 83817-44-1) is a chemical compound with the molecular formula C14H9BrN2O and a molecular weight of 301.14 g/mol. IUPAC name: 2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: AWSLTYZLUOJESZ-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | AWSLTYZLUOJESZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)