2-(3-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%
cas: 445303-10-6 — see every product listed under this CAS number, including other names
2-(3-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 445303-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1182KV-100mg |
| cas | 445303-10-6 |
| size | 100mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 741.20 Pln | |
| Chemat | 25g | 2954.00 Pln | |
| Chemat | 100g | 7845.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-10-6) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-(3-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UUZLARBBTZODKC-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-(3-chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UUZLARBBTZODKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-4-methylphenylboronic acid pinacol ester, 2-(3-chloro-4-methyl-phenyl)-4,4,5,5-tetramethyl [1,3,2]-dioxaborolane, UUZLARBBTZODKC-UHFFFAOYSA-N, 3-Chloro-4-methylphenylboronic acid, pinacol ester, 2-(3-chloro-4-methyl-phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(3-chloro-4-methyl-phenyl)-4,4,5,5-tetramethyl[1,3,2]-dioxaborolane