CAS 1365565-86-1 appears in our catalog under these names: 2-((2-Chlorophenyl)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-Chlorobenzylboronic acid pinacol ester. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,25g.
2-[(2-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1365565-86-1) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AOSUIVQGWGQTIJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AOSUIVQGWGQTIJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)