2-(3-Chlorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 517920-59-1 — see every product listed under this CAS number, including other names
2-(3-Chlorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 517920-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A158669-100mg |
| cas | 517920-59-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 25g | 3457.56 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 1114.08 Pln | |
| BLDpharm | 25g | 3724.27 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 310.32 Pln | |
| Fluorochem | 5g | 1070.47 Pln | |
| Fluorochem | 10g | 2059.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[(3-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 517920-59-1) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[(3-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HSRXSXFASWKTMZ-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HSRXSXFASWKTMZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)