cas: 1332336-58-9 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)-4-methylpyridine-5-carboxaldehyde (CAS 1332336-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632351-250MG |
| cas | 1332336-58-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 6256.15 Pln | |
| Fluorochem | 500mg | 7099.60 Pln |
| delivery time | 3-4 weeks |
|---|
6-(3-chlorophenyl)-4-methylpyridine-3-carbaldehyde (CAS 1332336-58-9) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 6-(3-chlorophenyl)-4-methylpyridine-3-carbaldehyde. InChIKey: WHFWULGIOGIKOU-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 6-(3-chlorophenyl)-4-methylpyridine-3-carbaldehyde |
| InChIKey | WHFWULGIOGIKOU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1C=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)