cas: 2121514-70-1 — see every product listed under this CAS number, including other names
2-(3-Cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 2121514-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XDQN-100mg |
| cas | 2121514-70-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1250.00 Pln | |
| Chemat | 250mg | 2080.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-70-1) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SSMKDNHRLVKRFB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SSMKDNHRLVKRFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3CCC3 |
Computed by PubChem (NCBI)