cas: 2121514-70-1 — see every product listed under this CAS number, including other names
3-Cyclobutylphenylboronic acid pinacol ester, 97% (CAS 2121514-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627718-100MG |
| cas | 2121514-70-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2559.53 Pln | |
| Fluorochem | 1g | 6813.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-70-1) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SSMKDNHRLVKRFB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SSMKDNHRLVKRFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3CCC3 |
Computed by PubChem (NCBI)