CAS 910242-00-1 appears in our catalog under these names: 2–(2–ethenylphenyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 4,4,5,5-Tetramethyl-2-(2-vinylphenyl)-1,3,2-dioxaborolane 98% mix TBC as stabilizer, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene, 97%, 97%, 4,4,5,5-Tetramethyl-2-(2-vinylphenyl)-1,3,2-dioxaborolane, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
2-(2-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 910242-00-1) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(2-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LMSISTSGLMQBGW-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(2-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LMSISTSGLMQBGW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C=C |
Computed by PubChem (NCBI)