CAS 143825-84-7 appears in our catalog under these names: 1-Phenylvinylboronic acid pinacol ester, 95% , 1-Phenylvinylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(1-phenylvinyl)-1,3,2-dioxaborolane 95%, 4,4,5,5-Tetramethyl-2-(1-phenylvinyl)-1,3,2-dioxaborolane, 97%, 97%, 4,4,5,5-Tetramethyl-2-(1-phenylvinyl)-1,3,2-dioxaborolane, 95%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 50g, 5g, 500g, 25g, 100g, 250mg, 10g.
4,4,5,5-tetramethyl-2-(1-phenylethenyl)-1,3,2-dioxaborolane (CAS 143825-84-7) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(1-phenylethenyl)-1,3,2-dioxaborolane. InChIKey: RMGBWPMWUZSIMH-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(1-phenylethenyl)-1,3,2-dioxaborolane |
| InChIKey | RMGBWPMWUZSIMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)