CAS 2225169-00-4 is the registry number for 3–Cyclopropyl–5–(cyclopentyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-cyclopentyl-5-cyclopropylphenyl)boronic acid (CAS 2225169-00-4) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: (3-cyclopentyl-5-cyclopropylphenyl)boronic acid. InChIKey: QVLURYFLAOAMRA-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | (3-cyclopentyl-5-cyclopropylphenyl)boronic acid |
| InChIKey | QVLURYFLAOAMRA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2CC2)C3CCCC3)(O)O |
Computed by PubChem (NCBI)