CAS 74213-48-2 appears in our catalog under these names: (Z)-4,4,5,5-Tetramethyl-2-styryl-1,3,2-dioxaborolane, 95%, (Z)-4,4,5,5-Tetramethyl-2-styryl-1,3,2-dioxaborolane 95%, (Z)-4,4,5,5-Tetramethyl-2-styryl-1,3,2-dioxaborolane, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 25mg, 50mg, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[(Z)-2-phenylethenyl]-1,3,2-dioxaborolane (CAS 74213-48-2) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(Z)-2-phenylethenyl]-1,3,2-dioxaborolane. InChIKey: ARAINKADEARZLZ-KHPPLWFESA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(Z)-2-phenylethenyl]-1,3,2-dioxaborolane |
| InChIKey | ARAINKADEARZLZ-KHPPLWFESA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\C2=CC=CC=C2 |
Computed by PubChem (NCBI)