cas: 132089-37-3 — see every product listed under this CAS number, including other names
2-(3-Fluoro-phenyl)-thiazole-4-carboxylic acid ethyl ester, 98%, 98% (CAS 132089-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11216Y-100mg |
| cas | 132089-37-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 155.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 132089-37-3) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: XFUVBMWVICIKSW-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | XFUVBMWVICIKSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)