Products 842115-87-1

CAS 842115-87-1 is the registry number for Ethyl 2-(2-fluorophenyl)-1,3-thiazole-4-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 842115-87-1) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(2-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: AMNMXIMEGAQNCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10FNO2S
Molecular weight251.28 g/mol
IUPAC nameethyl 2-(2-fluorophenyl)-1,3-thiazole-4-carboxylate
InChIKeyAMNMXIMEGAQNCZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC=CC=C2F

Computed by PubChem (NCBI)