CAS 1325307-27-4 is the registry number for Methyl 3-amino-4-(2-fluorophenyl)thiophene-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-amino-4-(2-fluorophenyl)thiophene-2-carboxylate (CAS 1325307-27-4) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: methyl 3-amino-4-(2-fluorophenyl)thiophene-2-carboxylate. InChIKey: VCVCSNZCXBQSEL-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | methyl 3-amino-4-(2-fluorophenyl)thiophene-2-carboxylate |
| InChIKey | VCVCSNZCXBQSEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)C2=CC=CC=C2F)N |
Computed by PubChem (NCBI)