cas: 886369-06-8 — see every product listed under this CAS number, including other names
2-(3-Fluorophenyl)-1,3-thiazole-4-carboxylic acid, 98%, 98% (CAS 886369-06-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GS62-250mg |
| cas | 886369-06-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 698.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 886369-06-8) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: NDPPYHUQIRQQLD-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NDPPYHUQIRQQLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)