cas: 886369-06-8 — see every product listed under this CAS number, including other names
2-(3-Fluorophenyl)thiazole-4-carboxylic acid, 98% (CAS 886369-06-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236549-1G |
| cas | 886369-06-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 924.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 886369-06-8) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: NDPPYHUQIRQQLD-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NDPPYHUQIRQQLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)