cas: 886369-06-8 — see every product listed under this CAS number, including other names
2-(3-Fluorophenyl)thiazole-4-carboxylic acid 98% (CAS 886369-06-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A239324-250mg |
| cas | 886369-06-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 843.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A239324 |
2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 886369-06-8) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: NDPPYHUQIRQQLD-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NDPPYHUQIRQQLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)