CAS 886366-96-7 appears in our catalog under these names: 4-(4-Fluorophenyl)-1,3-thiazole-2-carboxylic acid, 4-(4-Fluorophenyl)thiazole-2-carboxylic acid, 95%, 95%, 4-(4-Fluorophenyl)thiazole-2-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
4-(4-fluorophenyl)-1,3-thiazole-2-carboxylic acid (CAS 886366-96-7) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 4-(4-fluorophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: ADTZSCPHZARMBS-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | ADTZSCPHZARMBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C(=O)O)F |
Computed by PubChem (NCBI)