CAS 500605-08-3 appears in our catalog under these names: 2-(2-Fluorophenyl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(2-Fluorophenyl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(2-fluorophenyl)-1,3-thiazole-5-carboxylic acid (CAS 500605-08-3) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(2-fluorophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: XXKQUDUROIXGAP-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | XXKQUDUROIXGAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)