cas: 1159826-47-7 — see every product listed under this CAS number, including other names
2-(3-Methoxy-4-bromophenyl)-ethylamine hcl, 95%, 95% (CAS 1159826-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HD7G-100mg |
| cas | 1159826-47-7 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 520.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride (CAS 1159826-47-7) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: YXZWLBQGJTWRTR-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YXZWLBQGJTWRTR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCN)Br.Cl |
Computed by PubChem (NCBI)