Products 1213637-86-5
CAS 1213637-86-5 appears in our catalog under these names: (R)-(3-Bromophenyl)-beta-alaninol hydrochloride, 95%, (R)-(3-Bromophenyl)-beta-alaninol hydrochloride, 97%, (R)-3-Amino-3-(3-bromophenyl)propan-1-ol hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3R)-3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride (CAS 1213637-86-5) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: (3R)-3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride. InChIKey: VFRCPFDLHRPOIA-SBSPUUFOSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride |
| InChIKey | VFRCPFDLHRPOIA-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](CCO)N.Cl |
Computed by PubChem (NCBI)