CAS 1803592-85-9 appears in our catalog under these names: 1-Amino-2-(2-bromophenyl)propan-2-ol hydrochloride, 95%, 1-Amino-2-(2-bromophenyl)propan-2-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
1-amino-2-(2-bromophenyl)propan-2-ol;hydrochloride (CAS 1803592-85-9) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 1-amino-2-(2-bromophenyl)propan-2-ol;hydrochloride. InChIKey: FGKSQKOQKXFVDW-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 1-amino-2-(2-bromophenyl)propan-2-ol;hydrochloride |
| InChIKey | FGKSQKOQKXFVDW-UHFFFAOYSA-N |
| SMILES | CC(CN)(C1=CC=CC=C1Br)O.Cl |
Computed by PubChem (NCBI)