CAS 1955523-32-6 is the registry number for 1-(2-Bromo-4-methoxyphenyl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2-bromo-4-methoxyphenyl)ethanamine;hydrochloride (CAS 1955523-32-6) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 1-(2-bromo-4-methoxyphenyl)ethanamine;hydrochloride. InChIKey: XSPJNVXQPPZCEM-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 1-(2-bromo-4-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | XSPJNVXQPPZCEM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)OC)Br)N.Cl |
Computed by PubChem (NCBI)