CAS 1159826-47-7 appears in our catalog under these names: 2-(3-Methoxy-4-bromophenyl)-ethylamine hydrochloride, 96%, 2–(3–Methoxy–4–broMophenyl)–ethylaMine HCl, 2-(3-Methoxy-4-bromophenyl)-ethylamine hcl, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 0,25g, 100mg.
2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride (CAS 1159826-47-7) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: YXZWLBQGJTWRTR-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YXZWLBQGJTWRTR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCN)Br.Cl |
Computed by PubChem (NCBI)