cas: 886588-61-0 — see every product listed under this CAS number, including other names
2-(3R)-3-Piperidinyl-1H-isoindole-1,3(2H)-dione, 98%, 98% (CAS 886588-61-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H24S-1g |
| cas | 886588-61-0 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1216.40 Pln | |
| Chemat | 25g | 3717.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[(3R)-piperidin-3-yl]isoindole-1,3-dione (CAS 886588-61-0) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 2-[(3R)-piperidin-3-yl]isoindole-1,3-dione. InChIKey: POAZMSVKCTYEPJ-SECBINFHSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-[(3R)-piperidin-3-yl]isoindole-1,3-dione |
| InChIKey | POAZMSVKCTYEPJ-SECBINFHSA-N |
| SMILES | C1C[C@H](CNC1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)