cas: 38559-92-1 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)phenoxy)acetic acid 98% (CAS 38559-92-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A891326-100mg |
| cas | 38559-92-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 286.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A891326 |
2-(4-phenylmethoxyphenoxy)acetic acid (CAS 38559-92-1) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-(4-phenylmethoxyphenoxy)acetic acid. InChIKey: VXMSXBVTUNOSLL-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-(4-phenylmethoxyphenoxy)acetic acid |
| InChIKey | VXMSXBVTUNOSLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)