cas: 41360-55-8 — see every product listed under this CAS number, including other names
2-(4-(Trifluoromethyl)phenyl)acetamide 97% (CAS 41360-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A565169-100mg |
| cas | 41360-55-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 843.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A565169 |
2-[4-(trifluoromethyl)phenyl]acetamide (CAS 41360-55-8) is a chemical compound with the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]acetamide. InChIKey: CHGYICZMKKIHQI-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]acetamide |
| InChIKey | CHGYICZMKKIHQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)