2-(4-(tert-Butyl)phenyl)piperidine, 97%
cas: 383128-07-2 — see every product listed under this CAS number, including other names
2-(4-(tert-Butyl)phenyl)piperidine, 97% (CAS 383128-07-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A584781-100mg |
| cas | 383128-07-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2044.69 Pln | |
| BLDpharm | 100mg | 575.38 Pln | |
| BLDpharm | 250mg | 836.40 Pln | |
| BLDpharm | 1g | 2002.65 Pln | |
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 789.20 Pln | |
| Chemat | 1g | 1893.20 Pln | |
| Fluorochem | 100mg | 987.17 Pln | |
| Fluorochem | 250mg | 1460.96 Pln | |
| Fluorochem | 1g | 3491.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-tert-butylphenyl)piperidine (CAS 383128-07-2) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: 2-(4-tert-butylphenyl)piperidine. InChIKey: BVZADSBIWVFXJB-UHFFFAOYSA-N.
| Molecular formula | C15H23N |
|---|---|
| Molecular weight | 217.35 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)piperidine |
| InChIKey | BVZADSBIWVFXJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2CCCCN2 |
Computed by PubChem (NCBI)