CAS 148749-58-0 appears in our catalog under these names: (5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphth-2-yl)methylamine, 98%, (5,5,8,8–tetramethyl–5,6,7,8–tetrahydronaphthalen–2–yl)methanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanamine (CAS 148749-58-0) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanamine. InChIKey: GVSNYOXKXQRGRC-UHFFFAOYSA-N.
| Molecular formula | C15H23N |
|---|---|
| Molecular weight | 217.35 g/mol |
| IUPAC name | (5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanamine |
| InChIKey | GVSNYOXKXQRGRC-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)CN)(C)C)C |
Computed by PubChem (NCBI)