CAS 1213041-72-5 is the registry number for (R)-2-(2,3,4,5,6-Pentamethylphenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(2,3,4,5,6-pentamethylphenyl)pyrrolidine (CAS 1213041-72-5) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: (2R)-2-(2,3,4,5,6-pentamethylphenyl)pyrrolidine. InChIKey: FYKPJHGBHIOBKI-CQSZACIVSA-N.
| Molecular formula | C15H23N |
|---|---|
| Molecular weight | 217.35 g/mol |
| IUPAC name | (2R)-2-(2,3,4,5,6-pentamethylphenyl)pyrrolidine |
| InChIKey | FYKPJHGBHIOBKI-CQSZACIVSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)[C@H]2CCCN2)C)C |
Computed by PubChem (NCBI)