Products 173948-30-6

CAS 173948-30-6 appears in our catalog under these names: Tolterodine Impurity 23, Tolterodine Impurity B, Tolterodine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-3-phenyl-N,N-di(propan-2-yl)prop-2-en-1-amine (CAS 173948-30-6) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: (E)-3-phenyl-N,N-di(propan-2-yl)prop-2-en-1-amine. InChIKey: QOHVOTFSKSSADY-DHZHZOJOSA-N.

Identity
Molecular formulaC15H23N
Molecular weight217.35 g/mol
IUPAC name(E)-3-phenyl-N,N-di(propan-2-yl)prop-2-en-1-amine
InChIKeyQOHVOTFSKSSADY-DHZHZOJOSA-N
SMILESCC(C)N(C/C=C/C1=CC=CC=C1)C(C)C

Computed by PubChem (NCBI)