CAS 116233-17-1 appears in our catalog under these names: 3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-amine, 95%, 3,5,5,8,8–Pentamethyl–5,6,7,8–tetrahydronaphthalen–2–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 5g, 250mg.
3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine (CAS 116233-17-1) is a chemical compound with the molecular formula C15H23N and a molecular weight of 217.35 g/mol. IUPAC name: 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine. InChIKey: NDQSUCPZRPRYLX-UHFFFAOYSA-N.
| Molecular formula | C15H23N |
|---|---|
| Molecular weight | 217.35 g/mol |
| IUPAC name | 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine |
| InChIKey | NDQSUCPZRPRYLX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)