cas: 911708-01-5 — see every product listed under this CAS number, including other names
2-(4-Benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 911708-01-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691558-1G |
| cas | 911708-01-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 966.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 911708-01-5) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FPLGWDLJBAAWHO-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FPLGWDLJBAAWHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)