cas: 911708-01-5 — see every product listed under this CAS number, including other names
4-Benzylbenzeneboronic Acid Pinacol Ester, 97%, 97% (CAS 911708-01-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KSX-100mg |
| cas | 911708-01-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 911708-01-5) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FPLGWDLJBAAWHO-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-(4-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FPLGWDLJBAAWHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)