2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, 98%
cas: 10202-45-6 — see every product listed under this CAS number, including other names
2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, 98% (CAS 10202-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A623854-1g |
| cas | 10202-45-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 553.94 Pln | |
| Ambeed | 100g | 1705.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 181.07 Pln | |
| BLDpharm | 25g | 586.48 Pln | |
| BLDpharm | 100g | 1830.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine (CAS 10202-45-6) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine. InChIKey: JYPGHMDTTDKUEL-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine |
| InChIKey | JYPGHMDTTDKUEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, 2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine, 2-[1,1-biphenyl]-4-yl-4,6-dichloro-1,3,5-Triazine, 2,4-Dichloro-6-(biphenyl-4-yl)-1,3,5-triazine, 2-[1,1'-biphenyl]-4-yl-4,6-dichloro-1,3,5-triazine, 2-([1,1'-Biphenyl]-4-yl)-4,6-dichloro-1,3,5-triazine, 2,4-dichloro, 2-Biphenyl-4-yl-4,6-dichloro-[1,3,5]triazine