CAS 2891997-46-7 is the registry number for Anticancer agent 257. Offered by: MedChemExpress. Available pack sizes: Get quote.
12-chloro-11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (CAS 2891997-46-7) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 12-chloro-11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene. InChIKey: STCPQSIFMMXKMZ-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 12-chloro-11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| InChIKey | STCPQSIFMMXKMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N3C4=C(C=CC3=N2)NC=C4)Cl)Cl |
Computed by PubChem (NCBI)