CAS 30894-93-0 appears in our catalog under these names: 2-Chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine, 98+%, 2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine, 99%, 99%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250g, 500g, 1kg, 5g, 10g, 25g, 50g.
2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine (CAS 30894-93-0) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine. InChIKey: HLRNODHPMNYHKS-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine |
| InChIKey | HLRNODHPMNYHKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)