Products 2125473-29-0
CAS 2125473-29-0 is the registry number for 2-Chloro-4-(3-chlorophenyl)-6-phenyl-1，3，5-triazine, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
2-chloro-4-(3-chlorophenyl)-6-phenyl-1,3,5-triazine (CAS 2125473-29-0) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 2-chloro-4-(3-chlorophenyl)-6-phenyl-1,3,5-triazine. InChIKey: AOIZQBACFQBULG-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-chloro-4-(3-chlorophenyl)-6-phenyl-1,3,5-triazine |
| InChIKey | AOIZQBACFQBULG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)