CAS 10202-45-6 appears in our catalog under these names: 2–(4–Biphenylyl)–4,6–dichloro–1,3,5–triazine, 2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, >97.0%(GC)(N), 2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, 97%, 97%, 2-(4-BIPHENYLYL)-4,6-DICHLORO-1,3,5-TRIAZINE, 97%, 2-(4-Biphenylyl)-4,6-dichloro-1,3,5-triazine, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 200mg, 1g, 5g, 100g.
2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine (CAS 10202-45-6) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine. InChIKey: JYPGHMDTTDKUEL-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2,4-dichloro-6-(4-phenylphenyl)-1,3,5-triazine |
| InChIKey | JYPGHMDTTDKUEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)