cas: 1451391-15-3 — see every product listed under this CAS number, including other names
2-(4-Bromo-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1451391-15-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A423754-250mg |
| cas | 1451391-15-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 909.79 Pln | |
| AmBeed | 25g | 9887.08 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-bromo-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1451391-15-3) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(4-bromo-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XTPXMGSPEANYDN-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(4-bromo-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XTPXMGSPEANYDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)