CAS 1419602-18-8 is the registry number for 2,4-Difluoro-5-bromophenylboronic acid piancol ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 5g, 1g, 250mg.
2-(5-bromo-2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1419602-18-8) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(5-bromo-2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HSZKIXSOBZCUON-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(5-bromo-2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HSZKIXSOBZCUON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)F)Br |
Computed by PubChem (NCBI)