CAS 2121513-51-5 appears in our catalog under these names: 3-Bromo-2,6-difluorophenylboronic acid pinacol ester, 97%, 3-Bromo-2,6-difluorophenylboronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(3-bromo-2,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-51-5) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(3-bromo-2,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VXMXHIGXXVWUHO-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(3-bromo-2,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VXMXHIGXXVWUHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)Br)F |
Computed by PubChem (NCBI)