Products 2121515-07-7
CAS 2121515-07-7 appears in our catalog under these names: 4-Bromo-2,3-difluorophenylboronic acid pinacol ester, 95%, 2-(4-Bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 4-Bromo-2,3-difluorophenylboronic acid pinacol ester, ≥95%, ≥95%, 4-Bromo-2,3-difluorophenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
2-(4-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-07-7) is a chemical compound with the molecular formula C12H14BBrF2O2 and a molecular weight of 318.95 g/mol. IUPAC name: 2-(4-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RXYARMQADFUSTN-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrF2O2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 2-(4-bromo-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RXYARMQADFUSTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)